About ethyl 3-(2-hydroxy-4-azatricyclo[4.2.1.03,7]nonan-4-yl)butanoate
ethyl 3-(2-hydroxy-4-azatricyclo[4.2.1.03,7]nonan-4-yl)butanoate (PubChem CID 114247497) has the molecular formula C14H23NO3
and a molecular weight of 253.34 g/mol. Its IUPAC name is ethyl 3-(2-hydroxy-4-azatricyclo[4.2.1.03,7]nonan-4-yl)butanoate.
Molecular Properties
| Compound Name | ethyl 3-(2-hydroxy-4-azatricyclo[4.2.1.03,7]nonan-4-yl)butanoate |
| PubChem CID | 114247497 |
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | ethyl 3-(2-hydroxy-4-azatricyclo[4.2.1.03,7]nonan-4-yl)butanoate |
| SMILES | CCOC(=O)CC(C)N1CC2CC3CC2C1C3O |
| InChI | InChI=1S/C14H23NO3/c1-3-18-12(16)4-8(2)15-7-10-5-9-6-11(10)13(15)14(9)17/h8-11,13-14,17H,3-7H2,1-2H3 |
| InChIKey | DRPVEWZGXUFANR-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 3-(2-hydroxy-4-azatricyclo[4.2.1.03,7]nonan-4-yl)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-(2-hydroxy-4-azatricyclo[4.2.1.03,7]nonan-4-yl)butanoate?
The IUPAC name of ethyl 3-(2-hydroxy-4-azatricyclo[4.2.1.03,7]nonan-4-yl)butanoate (CID 114247497) is ethyl 3-(2-hydroxy-4-azatricyclo[4.2.1.03,7]nonan-4-yl)butanoate.
What is the SMILES notation for ethyl 3-(2-hydroxy-4-azatricyclo[4.2.1.03,7]nonan-4-yl)butanoate?
The canonical SMILES for ethyl 3-(2-hydroxy-4-azatricyclo[4.2.1.03,7]nonan-4-yl)butanoate is CCOC(=O)CC(C)N1CC2CC3CC2C1C3O.
What is the InChIKey of ethyl 3-(2-hydroxy-4-azatricyclo[4.2.1.03,7]nonan-4-yl)butanoate?
The InChIKey is DRPVEWZGXUFANR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23NO3/c1-3-18-12(16)4-8(2)15-7-10-5-9-6-11(10)13(15)14(9)17/h8-11,13-14,17H,3-7H2,1-2H3.
What are the key properties of ethyl 3-(2-hydroxy-4-azatricyclo[4.2.1.03,7]nonan-4-yl)butanoate?
ethyl 3-(2-hydroxy-4-azatricyclo[4.2.1.03,7]nonan-4-yl)butanoate has a molecular weight of 253.34 g/mol, XLogP of 1.03, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-(2-hydroxy-4-azatricyclo[4.2.1.03,7]nonan-4-yl)butanoate is sourced from PubChem (CID 114247497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).