About ethyl 2-(3-ethylsulfanylpropylcarbamoyl)-3,3-dimethylbutanoate
ethyl 2-(3-ethylsulfanylpropylcarbamoyl)-3,3-dimethylbutanoate (PubChem CID 114248459) has the molecular formula C14H27NO3S
and a molecular weight of 289.44 g/mol. Its IUPAC name is ethyl 2-(3-ethylsulfanylpropylcarbamoyl)-3,3-dimethylbutanoate.
Molecular Properties
| Compound Name | ethyl 2-(3-ethylsulfanylpropylcarbamoyl)-3,3-dimethylbutanoate |
| PubChem CID | 114248459 |
| Molecular Formula | C14H27NO3S |
| Molecular Weight | 289.44 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | ethyl 2-(3-ethylsulfanylpropylcarbamoyl)-3,3-dimethylbutanoate |
| SMILES | CCOC(=O)C(C(=O)NCCCSCC)C(C)(C)C |
| InChI | InChI=1S/C14H27NO3S/c1-6-18-13(17)11(14(3,4)5)12(16)15-9-8-10-19-7-2/h11H,6-10H2,1-5H3,(H,15,16) |
| InChIKey | WKWHWKLFGUXYCK-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.44 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-(3-ethylsulfanylpropylcarbamoyl)-3,3-dimethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(3-ethylsulfanylpropylcarbamoyl)-3,3-dimethylbutanoate?
The IUPAC name of ethyl 2-(3-ethylsulfanylpropylcarbamoyl)-3,3-dimethylbutanoate (CID 114248459) is ethyl 2-(3-ethylsulfanylpropylcarbamoyl)-3,3-dimethylbutanoate.
What is the SMILES notation for ethyl 2-(3-ethylsulfanylpropylcarbamoyl)-3,3-dimethylbutanoate?
The canonical SMILES for ethyl 2-(3-ethylsulfanylpropylcarbamoyl)-3,3-dimethylbutanoate is CCOC(=O)C(C(=O)NCCCSCC)C(C)(C)C.
What is the InChIKey of ethyl 2-(3-ethylsulfanylpropylcarbamoyl)-3,3-dimethylbutanoate?
The InChIKey is WKWHWKLFGUXYCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27NO3S/c1-6-18-13(17)11(14(3,4)5)12(16)15-9-8-10-19-7-2/h11H,6-10H2,1-5H3,(H,15,16).
What are the key properties of ethyl 2-(3-ethylsulfanylpropylcarbamoyl)-3,3-dimethylbutanoate?
ethyl 2-(3-ethylsulfanylpropylcarbamoyl)-3,3-dimethylbutanoate has a molecular weight of 289.44 g/mol, XLogP of 2.47, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(3-ethylsulfanylpropylcarbamoyl)-3,3-dimethylbutanoate is sourced from PubChem (CID 114248459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).