C15H21ClN2S — CID 114248532
2-(2-chloroethyl)-1-(3-ethylsulfanylpropyl)-7-methylbenzimidazole (PubChem CID 114248532) has the molecular formula C15H21ClN2S and a molecular weight of 296.87 g/mol. Its IUPAC name is 2-(2-chloroethyl)-1-(3-ethylsulfanylpropyl)-7-methylbenzimidazole.
| Compound Name | 2-(2-chloroethyl)-1-(3-ethylsulfanylpropyl)-7-methylbenzimidazole |
|---|---|
| PubChem CID | 114248532 |
| Molecular Formula | C15H21ClN2S |
| Molecular Weight | 296.87 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 2-(2-chloroethyl)-1-(3-ethylsulfanylpropyl)-7-methylbenzimidazole |
| SMILES | CCSCCCn1c(CCCl)nc2cccc(C)c21 |
| InChI | InChI=1S/C15H21ClN2S/c1-3-19-11-5-10-18-14(8-9-16)17-13-7-4-6-12(2)15(13)18/h4,6-7H,3,5,8-11H2,1-2H3 |
| InChIKey | YPBYTTHSVJHATR-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.87 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|