C14H20O3 — CID 11424883
methyl (3aS,4R,7aS)-2-acetyl-3a-methyl-1,4,5,6,7,7a-hexahydroindene-4-carboxylate (PubChem CID 11424883) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is methyl (3aS,4R,7aS)-2-acetyl-3a-methyl-1,4,5,6,7,7a-hexahydroindene-4-carboxylate.
| Compound Name | methyl (3aS,4R,7aS)-2-acetyl-3a-methyl-1,4,5,6,7,7a-hexahydroindene-4-carboxylate |
|---|---|
| PubChem CID | 11424883 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | methyl (3aS,4R,7aS)-2-acetyl-3a-methyl-1,4,5,6,7,7a-hexahydroindene-4-carboxylate |
| SMILES | COC(=O)[C@@H]1CCC[C@H]2CC(C(C)=O)=C[C@]21C |
| InChI | InChI=1S/C14H20O3/c1-9(15)10-7-11-5-4-6-12(13(16)17-3)14(11,2)8-10/h8,11-12H,4-7H2,1-3H3/t11-,12-,14+/m0/s1 |
| InChIKey | QQRBZSIGFUEPRF-SGMGOOAPSA-N |
| XLogP | 2.50 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |