C12H11BrClF5 — CID 114249301
2-bromo-4-(1-chloro-2,2,3,3,3-pentafluoropropyl)-1,3,5-trimethylbenzene (PubChem CID 114249301) has the molecular formula C12H11BrClF5 and a molecular weight of 365.57 g/mol. Its IUPAC name is 2-bromo-4-(1-chloro-2,2,3,3,3-pentafluoropropyl)-1,3,5-trimethylbenzene.
| Compound Name | 2-bromo-4-(1-chloro-2,2,3,3,3-pentafluoropropyl)-1,3,5-trimethylbenzene |
|---|---|
| PubChem CID | 114249301 |
| Molecular Formula | C12H11BrClF5 |
| Molecular Weight | 365.57 g/mol |
| Exact Mass | 363.97 |
| IUPAC Name | 2-bromo-4-(1-chloro-2,2,3,3,3-pentafluoropropyl)-1,3,5-trimethylbenzene |
| SMILES | Cc1cc(C)c(C(Cl)C(F)(F)C(F)(F)F)c(C)c1Br |
| InChI | InChI=1S/C12H11BrClF5/c1-5-4-6(2)9(13)7(3)8(5)10(14)11(15,16)12(17,18)19/h4,10H,1-3H3 |
| InChIKey | KRMUVCFDBYHOOL-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.57 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|