About 3-(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-4-methylpiperidin-4-ol
3-(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-4-methylpiperidin-4-ol (PubChem CID 114249783) has the molecular formula C15H28N2O
and a molecular weight of 252.40 g/mol. Its IUPAC name is 3-(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-4-methylpiperidin-4-ol.
Molecular Properties
| Compound Name | 3-(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-4-methylpiperidin-4-ol |
| PubChem CID | 114249783 |
| Molecular Formula | C15H28N2O |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.22 |
| IUPAC Name | 3-(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-4-methylpiperidin-4-ol |
| SMILES | CC(C)(C)C1=CCN(C2CNCCC2(C)O)CC1 |
| InChI | InChI=1S/C15H28N2O/c1-14(2,3)12-5-9-17(10-6-12)13-11-16-8-7-15(13,4)18/h5,13,16,18H,6-11H2,1-4H3 |
| InChIKey | WRGVRDPDBBRAER-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-4-methylpiperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-4-methylpiperidin-4-ol?
The IUPAC name of 3-(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-4-methylpiperidin-4-ol (CID 114249783) is 3-(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-4-methylpiperidin-4-ol.
What is the SMILES notation for 3-(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-4-methylpiperidin-4-ol?
The canonical SMILES for 3-(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-4-methylpiperidin-4-ol is CC(C)(C)C1=CCN(C2CNCCC2(C)O)CC1.
What is the InChIKey of 3-(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-4-methylpiperidin-4-ol?
The InChIKey is WRGVRDPDBBRAER-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28N2O/c1-14(2,3)12-5-9-17(10-6-12)13-11-16-8-7-15(13,4)18/h5,13,16,18H,6-11H2,1-4H3.
What are the key properties of 3-(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-4-methylpiperidin-4-ol?
3-(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-4-methylpiperidin-4-ol has a molecular weight of 252.40 g/mol, XLogP of 1.78, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-4-methylpiperidin-4-ol is sourced from PubChem (CID 114249783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).