C11H19N9 — CID 114250772
6-hydrazinyl-4-N,4-N-dimethyl-2-N-(1-propan-2-ylpyrazol-3-yl)-1,3,5-triazine-2,4-diamine (PubChem CID 114250772) has the molecular formula C11H19N9 and a molecular weight of 277.34 g/mol. Its IUPAC name is 6-hydrazinyl-4-N,4-N-dimethyl-2-N-(1-propan-2-ylpyrazol-3-yl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-hydrazinyl-4-N,4-N-dimethyl-2-N-(1-propan-2-ylpyrazol-3-yl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 114250772 |
| Molecular Formula | C11H19N9 |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | 6-hydrazinyl-4-N,4-N-dimethyl-2-N-(1-propan-2-ylpyrazol-3-yl)-1,3,5-triazine-2,4-diamine |
| SMILES | CC(C)n1ccc(Nc2nc(NN)nc(N(C)C)n2)n1 |
| InChI | InChI=1S/C11H19N9/c1-7(2)20-6-5-8(18-20)13-9-14-10(17-12)16-11(15-9)19(3)4/h5-7H,12H2,1-4H3,(H2,13,14,15,16,17,18) |
| InChIKey | AGSPKBKCEWGGJZ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 109.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|