C11H8ClFN2O3 — CID 114250791
1-(2-chloro-3-methylphenyl)-5-fluoro-1,3-diazinane-2,4,6-trione (PubChem CID 114250791) has the molecular formula C11H8ClFN2O3 and a molecular weight of 270.65 g/mol. Its IUPAC name is 1-(2-chloro-3-methylphenyl)-5-fluoro-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-(2-chloro-3-methylphenyl)-5-fluoro-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 114250791 |
| Molecular Formula | C11H8ClFN2O3 |
| Molecular Weight | 270.65 g/mol |
| Exact Mass | 270.02 |
| IUPAC Name | 1-(2-chloro-3-methylphenyl)-5-fluoro-1,3-diazinane-2,4,6-trione |
| SMILES | Cc1cccc(N2C(=O)NC(=O)C(F)C2=O)c1Cl |
| InChI | InChI=1S/C11H8ClFN2O3/c1-5-3-2-4-6(7(5)12)15-10(17)8(13)9(16)14-11(15)18/h2-4,8H,1H3,(H,14,16,18) |
| InChIKey | UMSJPNNKCFFMHK-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.65 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|