C13H11NO4 — CID 11425095
(4aS,10S)-10-methyl-4a,10-dihydro-4H-[1,3]oxazino[3,4-b]isoquinoline-1,3,5-trione (PubChem CID 11425095) has the molecular formula C13H11NO4 and a molecular weight of 245.23 g/mol. Its IUPAC name is (4aS,10S)-10-methyl-4a,10-dihydro-4H-[1,3]oxazino[3,4-b]isoquinoline-1,3,5-trione.
| Compound Name | (4aS,10S)-10-methyl-4a,10-dihydro-4H-[1,3]oxazino[3,4-b]isoquinoline-1,3,5-trione |
|---|---|
| PubChem CID | 11425095 |
| Molecular Formula | C13H11NO4 |
| Molecular Weight | 245.23 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | (4aS,10S)-10-methyl-4a,10-dihydro-4H-[1,3]oxazino[3,4-b]isoquinoline-1,3,5-trione |
| SMILES | C[C@H]1c2ccccc2C(=O)[C@@H]2CC(=O)OC(=O)N21 |
| InChI | InChI=1S/C13H11NO4/c1-7-8-4-2-3-5-9(8)12(16)10-6-11(15)18-13(17)14(7)10/h2-5,7,10H,6H2,1H3/t7-,10-/m0/s1 |
| InChIKey | GCMPHYSZLHZWOC-XVKPBYJWSA-N |
| XLogP | 1.68 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.23 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|