C17H26O — CID 11425131
(3aR,7aS)-4,5,6,7-tetraethyl-2,3,3a,7a-tetrahydroinden-1-one (PubChem CID 11425131) has the molecular formula C17H26O and a molecular weight of 246.39 g/mol. Its IUPAC name is (3aR,7aS)-4,5,6,7-tetraethyl-2,3,3a,7a-tetrahydroinden-1-one.
| Compound Name | (3aR,7aS)-4,5,6,7-tetraethyl-2,3,3a,7a-tetrahydroinden-1-one |
|---|---|
| PubChem CID | 11425131 |
| Molecular Formula | C17H26O |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.20 |
| IUPAC Name | (3aR,7aS)-4,5,6,7-tetraethyl-2,3,3a,7a-tetrahydroinden-1-one |
| SMILES | CCC1=C(CC)[C@H]2C(=O)CC[C@H]2C(CC)=C1CC |
| InChI | InChI=1S/C17H26O/c1-5-11-12(6-2)14(8-4)17-15(13(11)7-3)9-10-16(17)18/h15,17H,5-10H2,1-4H3/t15-,17+/m0/s1 |
| InChIKey | WEVMMCJPLPKGEH-DOTOQJQBSA-N |
| XLogP | 4.83 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |