C12H17N5O — CID 114251452
6-ethoxy-2-N-(1-ethylpyrazol-3-yl)pyridine-2,5-diamine (PubChem CID 114251452) has the molecular formula C12H17N5O and a molecular weight of 247.30 g/mol. Its IUPAC name is 6-ethoxy-2-N-(1-ethylpyrazol-3-yl)pyridine-2,5-diamine.
| Compound Name | 6-ethoxy-2-N-(1-ethylpyrazol-3-yl)pyridine-2,5-diamine |
|---|---|
| PubChem CID | 114251452 |
| Molecular Formula | C12H17N5O |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 6-ethoxy-2-N-(1-ethylpyrazol-3-yl)pyridine-2,5-diamine |
| SMILES | CCOc1nc(Nc2ccn(CC)n2)ccc1N |
| InChI | InChI=1S/C12H17N5O/c1-3-17-8-7-11(16-17)14-10-6-5-9(13)12(15-10)18-4-2/h5-8H,3-4,13H2,1-2H3,(H,14,15,16) |
| InChIKey | BUOMDQHEABIMFS-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |