C13H13FN4 — CID 114252043
3-[[(1-ethylpyrazol-3-yl)amino]methyl]-2-fluorobenzonitrile (PubChem CID 114252043) has the molecular formula C13H13FN4 and a molecular weight of 244.27 g/mol. Its IUPAC name is 3-[[(1-ethylpyrazol-3-yl)amino]methyl]-2-fluorobenzonitrile.
| Compound Name | 3-[[(1-ethylpyrazol-3-yl)amino]methyl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 114252043 |
| Molecular Formula | C13H13FN4 |
| Molecular Weight | 244.27 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | 3-[[(1-ethylpyrazol-3-yl)amino]methyl]-2-fluorobenzonitrile |
| SMILES | CCn1ccc(NCc2cccc(C#N)c2F)n1 |
| InChI | InChI=1S/C13H13FN4/c1-2-18-7-6-12(17-18)16-9-11-5-3-4-10(8-15)13(11)14/h3-7H,2,9H2,1H3,(H,16,17) |
| InChIKey | KOHQIKKHVUEMHZ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 53.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.27 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |