About 2-nitro-11H-indolo[1,2-b]indazole
2-nitro-11H-indolo[1,2-b]indazole (PubChem CID 11425243) has the molecular formula C14H9N3O2
and a molecular weight of 251.25 g/mol. Its IUPAC name is 2-nitro-11H-indolo[1,2-b]indazole.
Molecular Properties
| Compound Name | 2-nitro-11H-indolo[1,2-b]indazole |
| PubChem CID | 11425243 |
| Molecular Formula | C14H9N3O2 |
| Molecular Weight | 251.25 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 2-nitro-11H-indolo[1,2-b]indazole |
| SMILES | O=[N+]([O-])c1ccc2c(c1)Cc1c3ccccc3nn1-2 |
| InChI | InChI=1S/C14H9N3O2/c18-17(19)10-5-6-13-9(7-10)8-14-11-3-1-2-4-12(11)15-16(13)14/h1-7H,8H2 |
| InChIKey | FXIMARFIGFINRH-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 60.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.25 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-nitro-11H-indolo[1,2-b]indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nitro-11H-indolo[1,2-b]indazole?
The IUPAC name of 2-nitro-11H-indolo[1,2-b]indazole (CID 11425243) is 2-nitro-11H-indolo[1,2-b]indazole.
What is the SMILES notation for 2-nitro-11H-indolo[1,2-b]indazole?
The canonical SMILES for 2-nitro-11H-indolo[1,2-b]indazole is O=[N+]([O-])c1ccc2c(c1)Cc1c3ccccc3nn1-2.
What is the InChIKey of 2-nitro-11H-indolo[1,2-b]indazole?
The InChIKey is FXIMARFIGFINRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9N3O2/c18-17(19)10-5-6-13-9(7-10)8-14-11-3-1-2-4-12(11)15-16(13)14/h1-7H,8H2.
What are the key properties of 2-nitro-11H-indolo[1,2-b]indazole?
2-nitro-11H-indolo[1,2-b]indazole has a molecular weight of 251.25 g/mol, XLogP of 2.84, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nitro-11H-indolo[1,2-b]indazole is sourced from PubChem (CID 11425243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).