C14H22N2O2 — CID 114252667
4-(aminomethyl)-N-(5-methoxy-2-methylphenyl)oxan-4-amine (PubChem CID 114252667) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 4-(aminomethyl)-N-(5-methoxy-2-methylphenyl)oxan-4-amine.
| Compound Name | 4-(aminomethyl)-N-(5-methoxy-2-methylphenyl)oxan-4-amine |
|---|---|
| PubChem CID | 114252667 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 4-(aminomethyl)-N-(5-methoxy-2-methylphenyl)oxan-4-amine |
| SMILES | COc1ccc(C)c(NC2(CN)CCOCC2)c1 |
| InChI | InChI=1S/C14H22N2O2/c1-11-3-4-12(17-2)9-13(11)16-14(10-15)5-7-18-8-6-14/h3-4,9,16H,5-8,10,15H2,1-2H3 |
| InChIKey | KMILKZYUPWFIOV-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |