C13H14FN3O2 — CID 114253713
4-[[(1,5-dimethylpyrazol-3-yl)amino]methyl]-2-fluorobenzoic acid (PubChem CID 114253713) has the molecular formula C13H14FN3O2 and a molecular weight of 263.27 g/mol. Its IUPAC name is 4-[[(1,5-dimethylpyrazol-3-yl)amino]methyl]-2-fluorobenzoic acid.
| Compound Name | 4-[[(1,5-dimethylpyrazol-3-yl)amino]methyl]-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 114253713 |
| Molecular Formula | C13H14FN3O2 |
| Molecular Weight | 263.27 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | 4-[[(1,5-dimethylpyrazol-3-yl)amino]methyl]-2-fluorobenzoic acid |
| SMILES | Cc1cc(NCc2ccc(C(=O)O)c(F)c2)nn1C |
| InChI | InChI=1S/C13H14FN3O2/c1-8-5-12(16-17(8)2)15-7-9-3-4-10(13(18)19)11(14)6-9/h3-6H,7H2,1-2H3,(H,15,16)(H,18,19) |
| InChIKey | CLGQRBWLSJOCRR-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.27 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |