C12H15FN4O — CID 114254404
5-fluoro-N-[1-(3-methoxypropyl)imidazol-2-yl]pyridin-3-amine (PubChem CID 114254404) has the molecular formula C12H15FN4O and a molecular weight of 250.28 g/mol. Its IUPAC name is 5-fluoro-N-[1-(3-methoxypropyl)imidazol-2-yl]pyridin-3-amine.
| Compound Name | 5-fluoro-N-[1-(3-methoxypropyl)imidazol-2-yl]pyridin-3-amine |
|---|---|
| PubChem CID | 114254404 |
| Molecular Formula | C12H15FN4O |
| Molecular Weight | 250.28 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 5-fluoro-N-[1-(3-methoxypropyl)imidazol-2-yl]pyridin-3-amine |
| SMILES | COCCCn1ccnc1Nc1cncc(F)c1 |
| InChI | InChI=1S/C12H15FN4O/c1-18-6-2-4-17-5-3-15-12(17)16-11-7-10(13)8-14-9-11/h3,5,7-9H,2,4,6H2,1H3,(H,15,16) |
| InChIKey | KASYQLBKZOFZMH-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.28 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|