C13H16N4O2 — CID 11425447
(E,2R,3R)-3-azido-2-hydroxy-N,N-dimethyl-5-phenylpent-4-enamide (PubChem CID 11425447) has the molecular formula C13H16N4O2 and a molecular weight of 260.30 g/mol. Its IUPAC name is (E,2R,3R)-3-azido-2-hydroxy-N,N-dimethyl-5-phenylpent-4-enamide.
| Compound Name | (E,2R,3R)-3-azido-2-hydroxy-N,N-dimethyl-5-phenylpent-4-enamide |
|---|---|
| PubChem CID | 11425447 |
| Molecular Formula | C13H16N4O2 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | (E,2R,3R)-3-azido-2-hydroxy-N,N-dimethyl-5-phenylpent-4-enamide |
| SMILES | CN(C)C(=O)[C@H](O)[C@@H](/C=C/c1ccccc1)N=[N+]=[N-] |
| InChI | InChI=1S/C13H16N4O2/c1-17(2)13(19)12(18)11(15-16-14)9-8-10-6-4-3-5-7-10/h3-9,11-12,18H,1-2H3/b9-8+/t11-,12-/m1/s1 |
| InChIKey | XPFMTHJLNPCXDM-SVKHLYGUSA-N |
| XLogP | 1.83 |
| TPSA | 89.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|