C12H23NO5 — CID 11425480
tert-butyl 3-hydroxy-4,4-dimethoxypiperidine-1-carboxylate (PubChem CID 11425480) has the molecular formula C12H23NO5 and a molecular weight of 261.32 g/mol. Its IUPAC name is tert-butyl 3-hydroxy-4,4-dimethoxypiperidine-1-carboxylate.
| Compound Name | tert-butyl 3-hydroxy-4,4-dimethoxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 11425480 |
| Molecular Formula | C12H23NO5 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.16 |
| IUPAC Name | tert-butyl 3-hydroxy-4,4-dimethoxypiperidine-1-carboxylate |
| SMILES | COC1(OC)CCN(C(=O)OC(C)(C)C)CC1O |
| InChI | InChI=1S/C12H23NO5/c1-11(2,3)18-10(15)13-7-6-12(16-4,17-5)9(14)8-13/h9,14H,6-8H2,1-5H3 |
| InChIKey | NJRYBJQLRONERE-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|