About N-(2-aminoethyl)-N'-(5-methoxy-1-methylpyrazol-3-yl)oxamide
N-(2-aminoethyl)-N'-(5-methoxy-1-methylpyrazol-3-yl)oxamide (PubChem CID 114255303) has the molecular formula C9H15N5O3
and a molecular weight of 241.25 g/mol. Its IUPAC name is N-(2-aminoethyl)-N'-(5-methoxy-1-methylpyrazol-3-yl)oxamide.
Molecular Properties
| Compound Name | N-(2-aminoethyl)-N'-(5-methoxy-1-methylpyrazol-3-yl)oxamide |
| PubChem CID | 114255303 |
| Molecular Formula | C9H15N5O3 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | N-(2-aminoethyl)-N'-(5-methoxy-1-methylpyrazol-3-yl)oxamide |
| SMILES | COc1cc(NC(=O)C(=O)NCCN)nn1C |
| InChI | InChI=1S/C9H15N5O3/c1-14-7(17-2)5-6(13-14)12-9(16)8(15)11-4-3-10/h5H,3-4,10H2,1-2H3,(H,11,15)(H,12,13,16) |
| InChIKey | RDLAXWSWRVUPFI-UHFFFAOYSA-N |
| XLogP | -1.56 |
| TPSA | 111.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-(2-aminoethyl)-N'-(5-methoxy-1-methylpyrazol-3-yl)oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-aminoethyl)-N'-(5-methoxy-1-methylpyrazol-3-yl)oxamide?
The IUPAC name of N-(2-aminoethyl)-N'-(5-methoxy-1-methylpyrazol-3-yl)oxamide (CID 114255303) is N-(2-aminoethyl)-N'-(5-methoxy-1-methylpyrazol-3-yl)oxamide.
What is the SMILES notation for N-(2-aminoethyl)-N'-(5-methoxy-1-methylpyrazol-3-yl)oxamide?
The canonical SMILES for N-(2-aminoethyl)-N'-(5-methoxy-1-methylpyrazol-3-yl)oxamide is COc1cc(NC(=O)C(=O)NCCN)nn1C.
What is the InChIKey of N-(2-aminoethyl)-N'-(5-methoxy-1-methylpyrazol-3-yl)oxamide?
The InChIKey is RDLAXWSWRVUPFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N5O3/c1-14-7(17-2)5-6(13-14)12-9(16)8(15)11-4-3-10/h5H,3-4,10H2,1-2H3,(H,11,15)(H,12,13,16).
What are the key properties of N-(2-aminoethyl)-N'-(5-methoxy-1-methylpyrazol-3-yl)oxamide?
N-(2-aminoethyl)-N'-(5-methoxy-1-methylpyrazol-3-yl)oxamide has a molecular weight of 241.25 g/mol, XLogP of -1.56, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-aminoethyl)-N'-(5-methoxy-1-methylpyrazol-3-yl)oxamide is sourced from PubChem (CID 114255303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).