C9H15F3N4O — CID 114256044
N'-(5-methoxy-1-methylpyrazol-3-yl)-N-(2,2,2-trifluoroethyl)ethane-1,2-diamine (PubChem CID 114256044) has the molecular formula C9H15F3N4O and a molecular weight of 252.24 g/mol. Its IUPAC name is N'-(5-methoxy-1-methylpyrazol-3-yl)-N-(2,2,2-trifluoroethyl)ethane-1,2-diamine.
| Compound Name | N'-(5-methoxy-1-methylpyrazol-3-yl)-N-(2,2,2-trifluoroethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 114256044 |
| Molecular Formula | C9H15F3N4O |
| Molecular Weight | 252.24 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | N'-(5-methoxy-1-methylpyrazol-3-yl)-N-(2,2,2-trifluoroethyl)ethane-1,2-diamine |
| SMILES | COc1cc(NCCNCC(F)(F)F)nn1C |
| InChI | InChI=1S/C9H15F3N4O/c1-16-8(17-2)5-7(15-16)14-4-3-13-6-9(10,11)12/h5,13H,3-4,6H2,1-2H3,(H,14,15) |
| InChIKey | ILGRVFNBSWRTKG-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 51.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.24 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|