About 5-methoxy-1-N-(5-methoxy-1-methylpyrazol-3-yl)pentane-1,2-diamine
5-methoxy-1-N-(5-methoxy-1-methylpyrazol-3-yl)pentane-1,2-diamine (PubChem CID 114256046) has the molecular formula C11H22N4O2
and a molecular weight of 242.32 g/mol. Its IUPAC name is 5-methoxy-1-N-(5-methoxy-1-methylpyrazol-3-yl)pentane-1,2-diamine.
Molecular Properties
| Compound Name | 5-methoxy-1-N-(5-methoxy-1-methylpyrazol-3-yl)pentane-1,2-diamine |
| PubChem CID | 114256046 |
| Molecular Formula | C11H22N4O2 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | 5-methoxy-1-N-(5-methoxy-1-methylpyrazol-3-yl)pentane-1,2-diamine |
| SMILES | COCCCC(N)CNc1cc(OC)n(C)n1 |
| InChI | InChI=1S/C11H22N4O2/c1-15-11(17-3)7-10(14-15)13-8-9(12)5-4-6-16-2/h7,9H,4-6,8,12H2,1-3H3,(H,13,14) |
| InChIKey | BLKVLPIZGHOJNV-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-methoxy-1-N-(5-methoxy-1-methylpyrazol-3-yl)pentane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-1-N-(5-methoxy-1-methylpyrazol-3-yl)pentane-1,2-diamine?
The IUPAC name of 5-methoxy-1-N-(5-methoxy-1-methylpyrazol-3-yl)pentane-1,2-diamine (CID 114256046) is 5-methoxy-1-N-(5-methoxy-1-methylpyrazol-3-yl)pentane-1,2-diamine.
What is the SMILES notation for 5-methoxy-1-N-(5-methoxy-1-methylpyrazol-3-yl)pentane-1,2-diamine?
The canonical SMILES for 5-methoxy-1-N-(5-methoxy-1-methylpyrazol-3-yl)pentane-1,2-diamine is COCCCC(N)CNc1cc(OC)n(C)n1.
What is the InChIKey of 5-methoxy-1-N-(5-methoxy-1-methylpyrazol-3-yl)pentane-1,2-diamine?
The InChIKey is BLKVLPIZGHOJNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N4O2/c1-15-11(17-3)7-10(14-15)13-8-9(12)5-4-6-16-2/h7,9H,4-6,8,12H2,1-3H3,(H,13,14).
What are the key properties of 5-methoxy-1-N-(5-methoxy-1-methylpyrazol-3-yl)pentane-1,2-diamine?
5-methoxy-1-N-(5-methoxy-1-methylpyrazol-3-yl)pentane-1,2-diamine has a molecular weight of 242.32 g/mol, XLogP of 0.59, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-1-N-(5-methoxy-1-methylpyrazol-3-yl)pentane-1,2-diamine is sourced from PubChem (CID 114256046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).