C11H18N4O4 — CID 114256151
3-[(5-methoxy-1-methylpyrazol-3-yl)methylcarbamoylamino]-2-methylpropanoic acid (PubChem CID 114256151) has the molecular formula C11H18N4O4 and a molecular weight of 270.29 g/mol. Its IUPAC name is 3-[(5-methoxy-1-methylpyrazol-3-yl)methylcarbamoylamino]-2-methylpropanoic acid.
| Compound Name | 3-[(5-methoxy-1-methylpyrazol-3-yl)methylcarbamoylamino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 114256151 |
| Molecular Formula | C11H18N4O4 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | 3-[(5-methoxy-1-methylpyrazol-3-yl)methylcarbamoylamino]-2-methylpropanoic acid |
| SMILES | COc1cc(CNC(=O)NCC(C)C(=O)O)nn1C |
| InChI | InChI=1S/C11H18N4O4/c1-7(10(16)17)5-12-11(18)13-6-8-4-9(19-3)15(2)14-8/h4,7H,5-6H2,1-3H3,(H,16,17)(H2,12,13,18) |
| InChIKey | ZWDCITHSKWXDIG-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |