C13H20N2O4 — CID 11425643
methyl (3R,4aR,7aR)-3-acetamido-3-methyl-2-oxo-1,4,4a,5,6,7-hexahydrocyclopenta[b]pyridine-7a-carboxylate (PubChem CID 11425643) has the molecular formula C13H20N2O4 and a molecular weight of 268.31 g/mol. Its IUPAC name is methyl (3R,4aR,7aR)-3-acetamido-3-methyl-2-oxo-1,4,4a,5,6,7-hexahydrocyclopenta[b]pyridine-7a-carboxylate.
| Compound Name | methyl (3R,4aR,7aR)-3-acetamido-3-methyl-2-oxo-1,4,4a,5,6,7-hexahydrocyclopenta[b]pyridine-7a-carboxylate |
|---|---|
| PubChem CID | 11425643 |
| Molecular Formula | C13H20N2O4 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | methyl (3R,4aR,7aR)-3-acetamido-3-methyl-2-oxo-1,4,4a,5,6,7-hexahydrocyclopenta[b]pyridine-7a-carboxylate |
| SMILES | COC(=O)[C@@]12CCC[C@@H]1C[C@@](C)(NC(C)=O)C(=O)N2 |
| InChI | InChI=1S/C13H20N2O4/c1-8(16)14-12(2)7-9-5-4-6-13(9,11(18)19-3)15-10(12)17/h9H,4-7H2,1-3H3,(H,14,16)(H,15,17)/t9-,12-,13-/m1/s1 |
| InChIKey | NJWGSXSTAPZYJW-OASPWFOLSA-N |
| XLogP | 0.11 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |