C8H8F5N3O2 — CID 114256507
2,2,3,3,3-pentafluoro-N-(5-methoxy-1-methylpyrazol-3-yl)propanamide (PubChem CID 114256507) has the molecular formula C8H8F5N3O2 and a molecular weight of 273.16 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoro-N-(5-methoxy-1-methylpyrazol-3-yl)propanamide.
| Compound Name | 2,2,3,3,3-pentafluoro-N-(5-methoxy-1-methylpyrazol-3-yl)propanamide |
|---|---|
| PubChem CID | 114256507 |
| Molecular Formula | C8H8F5N3O2 |
| Molecular Weight | 273.16 g/mol |
| Exact Mass | 273.05 |
| IUPAC Name | 2,2,3,3,3-pentafluoro-N-(5-methoxy-1-methylpyrazol-3-yl)propanamide |
| SMILES | COc1cc(NC(=O)C(F)(F)C(F)(F)F)nn1C |
| InChI | InChI=1S/C8H8F5N3O2/c1-16-5(18-2)3-4(15-16)14-6(17)7(9,10)8(11,12)13/h3H,1-2H3,(H,14,15,17) |
| InChIKey | VQQPXSJNYRAJGX-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.16 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|