C13H17IN2S — CID 114257714
N-(5-iodo-2-methylphenyl)-4-propan-2-yl-4,5-dihydro-1,3-thiazol-2-amine (PubChem CID 114257714) has the molecular formula C13H17IN2S and a molecular weight of 360.26 g/mol. Its IUPAC name is N-(5-iodo-2-methylphenyl)-4-propan-2-yl-4,5-dihydro-1,3-thiazol-2-amine.
| Compound Name | N-(5-iodo-2-methylphenyl)-4-propan-2-yl-4,5-dihydro-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 114257714 |
| Molecular Formula | C13H17IN2S |
| Molecular Weight | 360.26 g/mol |
| Exact Mass | 360.02 |
| IUPAC Name | N-(5-iodo-2-methylphenyl)-4-propan-2-yl-4,5-dihydro-1,3-thiazol-2-amine |
| SMILES | Cc1ccc(I)cc1NC1=NC(C(C)C)CS1 |
| InChI | InChI=1S/C13H17IN2S/c1-8(2)12-7-17-13(16-12)15-11-6-10(14)5-4-9(11)3/h4-6,8,12H,7H2,1-3H3,(H,15,16) |
| InChIKey | ZRBINJKZUJBGOA-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.26 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|