C11H22Sn — CID 11425779
trimethyl-[(2Z,4E)-4-methylhepta-2,4-dien-2-yl]stannane (PubChem CID 11425779) has the molecular formula C11H22Sn and a molecular weight of 273.01 g/mol. Its IUPAC name is trimethyl-[(2Z,4E)-4-methylhepta-2,4-dien-2-yl]stannane.
| Compound Name | trimethyl-[(2Z,4E)-4-methylhepta-2,4-dien-2-yl]stannane |
|---|---|
| PubChem CID | 11425779 |
| Molecular Formula | C11H22Sn |
| Molecular Weight | 273.01 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | trimethyl-[(2Z,4E)-4-methylhepta-2,4-dien-2-yl]stannane |
| SMILES | CC/C=C(C)/C=C(/C)[Sn](C)(C)C |
| InChI | InChI=1S/C8H13.3CH3.Sn/c1-4-6-8(3)7-5-2;;;;/h6-7H,4H2,1-3H3;3*1H3;/b7-5?,8-6+;;;; |
| InChIKey | LXHBOCBFDTYFPH-RQOCZZRHSA-N |
| XLogP | 4.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.01 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|