About 2-[(1E)-4,4-bis(methylsulfanyl)-2-nitrobuta-1,3-dienyl]thiophene
2-[(1E)-4,4-bis(methylsulfanyl)-2-nitrobuta-1,3-dienyl]thiophene (PubChem CID 11425798) has the molecular formula C10H11NO2S3
and a molecular weight of 273.40 g/mol. Its IUPAC name is 2-[(1E)-4,4-bis(methylsulfanyl)-2-nitrobuta-1,3-dienyl]thiophene.
Molecular Properties
| Compound Name | 2-[(1E)-4,4-bis(methylsulfanyl)-2-nitrobuta-1,3-dienyl]thiophene |
| PubChem CID | 11425798 |
| Molecular Formula | C10H11NO2S3 |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.00 |
| IUPAC Name | 2-[(1E)-4,4-bis(methylsulfanyl)-2-nitrobuta-1,3-dienyl]thiophene |
| SMILES | CSC(=C/C(=C\c1cccs1)[N+](=O)[O-])SC |
| InChI | InChI=1S/C10H11NO2S3/c1-14-10(15-2)7-8(11(12)13)6-9-4-3-5-16-9/h3-7H,1-2H3/b8-6+ |
| InChIKey | ABGOSEUUVJIPGR-SOFGYWHQSA-N |
| XLogP | 3.93 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1E)-4,4-bis(methylsulfanyl)-2-nitrobuta-1,3-dienyl]thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1E)-4,4-bis(methylsulfanyl)-2-nitrobuta-1,3-dienyl]thiophene?
The IUPAC name of 2-[(1E)-4,4-bis(methylsulfanyl)-2-nitrobuta-1,3-dienyl]thiophene (CID 11425798) is 2-[(1E)-4,4-bis(methylsulfanyl)-2-nitrobuta-1,3-dienyl]thiophene.
What is the SMILES notation for 2-[(1E)-4,4-bis(methylsulfanyl)-2-nitrobuta-1,3-dienyl]thiophene?
The canonical SMILES for 2-[(1E)-4,4-bis(methylsulfanyl)-2-nitrobuta-1,3-dienyl]thiophene is CSC(=C/C(=C\c1cccs1)[N+](=O)[O-])SC.
What is the InChIKey of 2-[(1E)-4,4-bis(methylsulfanyl)-2-nitrobuta-1,3-dienyl]thiophene?
The InChIKey is ABGOSEUUVJIPGR-SOFGYWHQSA-N. The full InChI is InChI=1S/C10H11NO2S3/c1-14-10(15-2)7-8(11(12)13)6-9-4-3-5-16-9/h3-7H,1-2H3/b8-6+.
What are the key properties of 2-[(1E)-4,4-bis(methylsulfanyl)-2-nitrobuta-1,3-dienyl]thiophene?
2-[(1E)-4,4-bis(methylsulfanyl)-2-nitrobuta-1,3-dienyl]thiophene has a molecular weight of 273.40 g/mol, XLogP of 3.93, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1E)-4,4-bis(methylsulfanyl)-2-nitrobuta-1,3-dienyl]thiophene is sourced from PubChem (CID 11425798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).