C11H8Br2IN3 — CID 114258679
5-bromo-4-N-(5-bromo-2-iodophenyl)pyridine-3,4-diamine (PubChem CID 114258679) has the molecular formula C11H8Br2IN3 and a molecular weight of 468.92 g/mol. Its IUPAC name is 5-bromo-4-N-(5-bromo-2-iodophenyl)pyridine-3,4-diamine.
| Compound Name | 5-bromo-4-N-(5-bromo-2-iodophenyl)pyridine-3,4-diamine |
|---|---|
| PubChem CID | 114258679 |
| Molecular Formula | C11H8Br2IN3 |
| Molecular Weight | 468.92 g/mol |
| Exact Mass | 466.81 |
| IUPAC Name | 5-bromo-4-N-(5-bromo-2-iodophenyl)pyridine-3,4-diamine |
| SMILES | Nc1cncc(Br)c1Nc1cc(Br)ccc1I |
| InChI | InChI=1S/C11H8Br2IN3/c12-6-1-2-8(14)10(3-6)17-11-7(13)4-16-5-9(11)15/h1-5H,15H2,(H,16,17) |
| InChIKey | SXETWRUNTPFNED-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.92 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|