C17H24O3 — CID 11425874
1-[(E)-but-2-enyl]-4-ethoxy-5-methoxy-2-(prop-2-enoxymethyl)benzene (PubChem CID 11425874) has the molecular formula C17H24O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is 1-[(E)-but-2-enyl]-4-ethoxy-5-methoxy-2-(prop-2-enoxymethyl)benzene.
| Compound Name | 1-[(E)-but-2-enyl]-4-ethoxy-5-methoxy-2-(prop-2-enoxymethyl)benzene |
|---|---|
| PubChem CID | 11425874 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | 1-[(E)-but-2-enyl]-4-ethoxy-5-methoxy-2-(prop-2-enoxymethyl)benzene |
| SMILES | C=CCOCc1cc(OCC)c(OC)cc1C/C=C/C |
| InChI | InChI=1S/C17H24O3/c1-5-8-9-14-11-16(18-4)17(20-7-3)12-15(14)13-19-10-6-2/h5-6,8,11-12H,2,7,9-10,13H2,1,3-4H3/b8-5+ |
| InChIKey | WHLDRCMIBMZQGK-VMPITWQZSA-N |
| XLogP | 3.92 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|