C18H28O2 — CID 11425881
(4aR,5E,8aR)-2',2'-dimethyl-5-propylidenespiro[1,2,4a,6,7,8a-hexahydronaphthalene-8,5'-1,3-dioxane] (PubChem CID 11425881) has the molecular formula C18H28O2 and a molecular weight of 276.42 g/mol. Its IUPAC name is (4aR,5E,8aR)-2',2'-dimethyl-5-propylidenespiro[1,2,4a,6,7,8a-hexahydronaphthalene-8,5'-1,3-dioxane].
| Compound Name | (4aR,5E,8aR)-2',2'-dimethyl-5-propylidenespiro[1,2,4a,6,7,8a-hexahydronaphthalene-8,5'-1,3-dioxane] |
|---|---|
| PubChem CID | 11425881 |
| Molecular Formula | C18H28O2 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | (4aR,5E,8aR)-2',2'-dimethyl-5-propylidenespiro[1,2,4a,6,7,8a-hexahydronaphthalene-8,5'-1,3-dioxane] |
| SMILES | CC/C=C1\CCC2(COC(C)(C)OC2)[C@@H]2CCC=C[C@@H]12 |
| InChI | InChI=1S/C18H28O2/c1-4-7-14-10-11-18(12-19-17(2,3)20-13-18)16-9-6-5-8-15(14)16/h5,7-8,15-16H,4,6,9-13H2,1-3H3/b14-7+/t15-,16+/m0/s1 |
| InChIKey | ZMCHUCSGCRXIIU-DMNRVOQQSA-N |
| XLogP | 4.47 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|