C13H9BrF2IN — CID 114259317
5-bromo-N-[(3,5-difluorophenyl)methyl]-2-iodoaniline (PubChem CID 114259317) has the molecular formula C13H9BrF2IN and a molecular weight of 424.03 g/mol. Its IUPAC name is 5-bromo-N-[(3,5-difluorophenyl)methyl]-2-iodoaniline.
| Compound Name | 5-bromo-N-[(3,5-difluorophenyl)methyl]-2-iodoaniline |
|---|---|
| PubChem CID | 114259317 |
| Molecular Formula | C13H9BrF2IN |
| Molecular Weight | 424.03 g/mol |
| Exact Mass | 422.89 |
| IUPAC Name | 5-bromo-N-[(3,5-difluorophenyl)methyl]-2-iodoaniline |
| SMILES | Fc1cc(F)cc(CNc2cc(Br)ccc2I)c1 |
| InChI | InChI=1S/C13H9BrF2IN/c14-9-1-2-12(17)13(5-9)18-7-8-3-10(15)6-11(16)4-8/h1-6,18H,7H2 |
| InChIKey | CHCFACJMKSLIIO-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.03 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|