About [(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 3-chlorobenzoate
[(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 3-chlorobenzoate (PubChem CID 11425966) has the molecular formula C15H18ClNO2
and a molecular weight of 279.77 g/mol. Its IUPAC name is [(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 3-chlorobenzoate.
Molecular Properties
| Compound Name | [(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 3-chlorobenzoate |
| PubChem CID | 11425966 |
| Molecular Formula | C15H18ClNO2 |
| Molecular Weight | 279.77 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | [(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 3-chlorobenzoate |
| SMILES | CN1[C@@H]2CC[C@H]1CC(OC(=O)c1cccc(Cl)c1)C2 |
| InChI | InChI=1S/C15H18ClNO2/c1-17-12-5-6-13(17)9-14(8-12)19-15(18)10-3-2-4-11(16)7-10/h2-4,7,12-14H,5-6,8-9H2,1H3/t12-,13+,14? |
| InChIKey | UFYVJVZKHDCQOH-PBWFPOADSA-N |
| XLogP | 3.12 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.77 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 3-chlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 3-chlorobenzoate?
The IUPAC name of [(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 3-chlorobenzoate (CID 11425966) is [(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 3-chlorobenzoate.
What is the SMILES notation for [(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 3-chlorobenzoate?
The canonical SMILES for [(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 3-chlorobenzoate is CN1[C@@H]2CC[C@H]1CC(OC(=O)c1cccc(Cl)c1)C2.
What is the InChIKey of [(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 3-chlorobenzoate?
The InChIKey is UFYVJVZKHDCQOH-PBWFPOADSA-N. The full InChI is InChI=1S/C15H18ClNO2/c1-17-12-5-6-13(17)9-14(8-12)19-15(18)10-3-2-4-11(16)7-10/h2-4,7,12-14H,5-6,8-9H2,1H3/t12-,13+,14?.
What are the key properties of [(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 3-chlorobenzoate?
[(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 3-chlorobenzoate has a molecular weight of 279.77 g/mol, XLogP of 3.12, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 3-chlorobenzoate is sourced from PubChem (CID 11425966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).