C10H17IO — CID 11425969
(2R,3S)-3-(iodomethyl)-2-methyl-2-(4-methylpent-3-enyl)oxirane (PubChem CID 11425969) has the molecular formula C10H17IO and a molecular weight of 280.15 g/mol. Its IUPAC name is (2R,3S)-3-(iodomethyl)-2-methyl-2-(4-methylpent-3-enyl)oxirane.
| Compound Name | (2R,3S)-3-(iodomethyl)-2-methyl-2-(4-methylpent-3-enyl)oxirane |
|---|---|
| PubChem CID | 11425969 |
| Molecular Formula | C10H17IO |
| Molecular Weight | 280.15 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | (2R,3S)-3-(iodomethyl)-2-methyl-2-(4-methylpent-3-enyl)oxirane |
| SMILES | CC(C)=CCC[C@@]1(C)O[C@@H]1CI |
| InChI | InChI=1S/C10H17IO/c1-8(2)5-4-6-10(3)9(7-11)12-10/h5,9H,4,6-7H2,1-3H3/t9-,10-/m1/s1 |
| InChIKey | AWAUZISYHREEIC-NXEZZACHSA-N |
| XLogP | 3.33 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.15 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|