C10H11FINO3S — CID 114259861
4-(3-fluoro-2-iodoanilino)-1,1-dioxothiolan-3-ol (PubChem CID 114259861) has the molecular formula C10H11FINO3S and a molecular weight of 371.17 g/mol. Its IUPAC name is 4-(3-fluoro-2-iodoanilino)-1,1-dioxothiolan-3-ol.
| Compound Name | 4-(3-fluoro-2-iodoanilino)-1,1-dioxothiolan-3-ol |
|---|---|
| PubChem CID | 114259861 |
| Molecular Formula | C10H11FINO3S |
| Molecular Weight | 371.17 g/mol |
| Exact Mass | 370.95 |
| IUPAC Name | 4-(3-fluoro-2-iodoanilino)-1,1-dioxothiolan-3-ol |
| SMILES | O=S1(=O)CC(O)C(Nc2cccc(F)c2I)C1 |
| InChI | InChI=1S/C10H11FINO3S/c11-6-2-1-3-7(10(6)12)13-8-4-17(15,16)5-9(8)14/h1-3,8-9,13-14H,4-5H2 |
| InChIKey | CWPQOIUXUCZPIZ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.17 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|