About 3-(2,6-diethylphenyl)-1,4-dihydroquinazolin-2-one
3-(2,6-diethylphenyl)-1,4-dihydroquinazolin-2-one (PubChem CID 11425997) has the molecular formula C18H20N2O
and a molecular weight of 280.37 g/mol. Its IUPAC name is 3-(2,6-diethylphenyl)-1,4-dihydroquinazolin-2-one.
Molecular Properties
| Compound Name | 3-(2,6-diethylphenyl)-1,4-dihydroquinazolin-2-one |
| PubChem CID | 11425997 |
| Molecular Formula | C18H20N2O |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 3-(2,6-diethylphenyl)-1,4-dihydroquinazolin-2-one |
| SMILES | CCc1cccc(CC)c1N1Cc2ccccc2NC1=O |
| InChI | InChI=1S/C18H20N2O/c1-3-13-9-7-10-14(4-2)17(13)20-12-15-8-5-6-11-16(15)19-18(20)21/h5-11H,3-4,12H2,1-2H3,(H,19,21) |
| InChIKey | YKAYEIBOKQAYSU-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-(2,6-diethylphenyl)-1,4-dihydroquinazolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,6-diethylphenyl)-1,4-dihydroquinazolin-2-one?
The IUPAC name of 3-(2,6-diethylphenyl)-1,4-dihydroquinazolin-2-one (CID 11425997) is 3-(2,6-diethylphenyl)-1,4-dihydroquinazolin-2-one.
What is the SMILES notation for 3-(2,6-diethylphenyl)-1,4-dihydroquinazolin-2-one?
The canonical SMILES for 3-(2,6-diethylphenyl)-1,4-dihydroquinazolin-2-one is CCc1cccc(CC)c1N1Cc2ccccc2NC1=O.
What is the InChIKey of 3-(2,6-diethylphenyl)-1,4-dihydroquinazolin-2-one?
The InChIKey is YKAYEIBOKQAYSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N2O/c1-3-13-9-7-10-14(4-2)17(13)20-12-15-8-5-6-11-16(15)19-18(20)21/h5-11H,3-4,12H2,1-2H3,(H,19,21).
What are the key properties of 3-(2,6-diethylphenyl)-1,4-dihydroquinazolin-2-one?
3-(2,6-diethylphenyl)-1,4-dihydroquinazolin-2-one has a molecular weight of 280.37 g/mol, XLogP of 4.36, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,6-diethylphenyl)-1,4-dihydroquinazolin-2-one is sourced from PubChem (CID 11425997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).