About 3-(2,3,3-trimethylindol-1-ium-1-yl)propane-1-sulfonate
3-(2,3,3-trimethylindol-1-ium-1-yl)propane-1-sulfonate (PubChem CID 11426025) has the molecular formula C14H19NO3S
and a molecular weight of 281.38 g/mol. Its IUPAC name is 3-(2,3,3-trimethylindol-1-ium-1-yl)propane-1-sulfonate.
Molecular Properties
| Compound Name | 3-(2,3,3-trimethylindol-1-ium-1-yl)propane-1-sulfonate |
| PubChem CID | 11426025 |
| Molecular Formula | C14H19NO3S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | 3-(2,3,3-trimethylindol-1-ium-1-yl)propane-1-sulfonate |
| SMILES | CC1=[N+](CCCS(=O)(=O)[O-])c2ccccc2C1(C)C |
| InChI | InChI=1S/C14H19NO3S/c1-11-14(2,3)12-7-4-5-8-13(12)15(11)9-6-10-19(16,17)18/h4-5,7-8H,6,9-10H2,1-3H3 |
| InChIKey | SWJIXAVSSKFOEY-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,3,3-trimethylindol-1-ium-1-yl)propane-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,3,3-trimethylindol-1-ium-1-yl)propane-1-sulfonate?
The IUPAC name of 3-(2,3,3-trimethylindol-1-ium-1-yl)propane-1-sulfonate (CID 11426025) is 3-(2,3,3-trimethylindol-1-ium-1-yl)propane-1-sulfonate.
What is the SMILES notation for 3-(2,3,3-trimethylindol-1-ium-1-yl)propane-1-sulfonate?
The canonical SMILES for 3-(2,3,3-trimethylindol-1-ium-1-yl)propane-1-sulfonate is CC1=[N+](CCCS(=O)(=O)[O-])c2ccccc2C1(C)C.
What is the InChIKey of 3-(2,3,3-trimethylindol-1-ium-1-yl)propane-1-sulfonate?
The InChIKey is SWJIXAVSSKFOEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO3S/c1-11-14(2,3)12-7-4-5-8-13(12)15(11)9-6-10-19(16,17)18/h4-5,7-8H,6,9-10H2,1-3H3.
What are the key properties of 3-(2,3,3-trimethylindol-1-ium-1-yl)propane-1-sulfonate?
3-(2,3,3-trimethylindol-1-ium-1-yl)propane-1-sulfonate has a molecular weight of 281.38 g/mol, XLogP of 2.02, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,3,3-trimethylindol-1-ium-1-yl)propane-1-sulfonate is sourced from PubChem (CID 11426025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).