C16H27NO3 — CID 11426028
heptyl (7R,8R)-7-methyl-2-oxo-1,3,5,6,7,8-hexahydropyrrolizine-1-carboxylate (PubChem CID 11426028) has the molecular formula C16H27NO3 and a molecular weight of 281.40 g/mol. Its IUPAC name is heptyl (7R,8R)-7-methyl-2-oxo-1,3,5,6,7,8-hexahydropyrrolizine-1-carboxylate.
| Compound Name | heptyl (7R,8R)-7-methyl-2-oxo-1,3,5,6,7,8-hexahydropyrrolizine-1-carboxylate |
|---|---|
| PubChem CID | 11426028 |
| Molecular Formula | C16H27NO3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | heptyl (7R,8R)-7-methyl-2-oxo-1,3,5,6,7,8-hexahydropyrrolizine-1-carboxylate |
| SMILES | CCCCCCCOC(=O)C1C(=O)CN2CC[C@@H](C)[C@H]12 |
| InChI | InChI=1S/C16H27NO3/c1-3-4-5-6-7-10-20-16(19)14-13(18)11-17-9-8-12(2)15(14)17/h12,14-15H,3-11H2,1-2H3/t12-,14?,15-/m1/s1 |
| InChIKey | UGAACKWATAFNRG-SULGFLJSSA-N |
| XLogP | 2.41 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|