C12H9BrINO2 — CID 114260868
9-bromo-6-iodo-1,3,4,5-tetrahydropyrano[4,3-b]quinolin-10-one (PubChem CID 114260868) has the molecular formula C12H9BrINO2 and a molecular weight of 406.02 g/mol. Its IUPAC name is 9-bromo-6-iodo-1,3,4,5-tetrahydropyrano[4,3-b]quinolin-10-one.
| Compound Name | 9-bromo-6-iodo-1,3,4,5-tetrahydropyrano[4,3-b]quinolin-10-one |
|---|---|
| PubChem CID | 114260868 |
| Molecular Formula | C12H9BrINO2 |
| Molecular Weight | 406.02 g/mol |
| Exact Mass | 404.89 |
| IUPAC Name | 9-bromo-6-iodo-1,3,4,5-tetrahydropyrano[4,3-b]quinolin-10-one |
| SMILES | O=c1c2c([nH]c3c(I)ccc(Br)c13)CCOC2 |
| InChI | InChI=1S/C12H9BrINO2/c13-7-1-2-8(14)11-10(7)12(16)6-5-17-4-3-9(6)15-11/h1-2H,3-5H2,(H,15,16) |
| InChIKey | KLWLIIIIZQXMRJ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.02 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|