C11H12ClIN4 — CID 114261207
N-[[1-(2-chloro-5-iodophenyl)triazol-4-yl]methyl]ethanamine (PubChem CID 114261207) has the molecular formula C11H12ClIN4 and a molecular weight of 362.60 g/mol. Its IUPAC name is N-[[1-(2-chloro-5-iodophenyl)triazol-4-yl]methyl]ethanamine.
| Compound Name | N-[[1-(2-chloro-5-iodophenyl)triazol-4-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 114261207 |
| Molecular Formula | C11H12ClIN4 |
| Molecular Weight | 362.60 g/mol |
| Exact Mass | 361.98 |
| IUPAC Name | N-[[1-(2-chloro-5-iodophenyl)triazol-4-yl]methyl]ethanamine |
| SMILES | CCNCc1cn(-c2cc(I)ccc2Cl)nn1 |
| InChI | InChI=1S/C11H12ClIN4/c1-2-14-6-9-7-17(16-15-9)11-5-8(13)3-4-10(11)12/h3-5,7,14H,2,6H2,1H3 |
| InChIKey | OQKTURZNRUTRDK-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.60 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|