C14H11BrINO2 — CID 114262209
(3aS,7aR)-2-(3-bromo-4-iodophenyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 114262209) has the molecular formula C14H11BrINO2 and a molecular weight of 432.06 g/mol. Its IUPAC name is (3aS,7aR)-2-(3-bromo-4-iodophenyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aS,7aR)-2-(3-bromo-4-iodophenyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 114262209 |
| Molecular Formula | C14H11BrINO2 |
| Molecular Weight | 432.06 g/mol |
| Exact Mass | 430.90 |
| IUPAC Name | (3aS,7aR)-2-(3-bromo-4-iodophenyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | O=C1[C@H]2CC=CC[C@H]2C(=O)N1c1ccc(I)c(Br)c1 |
| InChI | InChI=1S/C14H11BrINO2/c15-11-7-8(5-6-12(11)16)17-13(18)9-3-1-2-4-10(9)14(17)19/h1-2,5-7,9-10H,3-4H2/t9-,10+ |
| InChIKey | DTBICSGWTGMWOI-AOOOYVTPSA-N |
| XLogP | 3.51 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.06 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|