C12H12BrIN4 — CID 114262788
4-N-(3-bromo-4-iodophenyl)-6-N,5-dimethylpyrimidine-4,6-diamine (PubChem CID 114262788) has the molecular formula C12H12BrIN4 and a molecular weight of 419.06 g/mol. Its IUPAC name is 4-N-(3-bromo-4-iodophenyl)-6-N,5-dimethylpyrimidine-4,6-diamine.
| Compound Name | 4-N-(3-bromo-4-iodophenyl)-6-N,5-dimethylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 114262788 |
| Molecular Formula | C12H12BrIN4 |
| Molecular Weight | 419.06 g/mol |
| Exact Mass | 417.93 |
| IUPAC Name | 4-N-(3-bromo-4-iodophenyl)-6-N,5-dimethylpyrimidine-4,6-diamine |
| SMILES | CNc1ncnc(Nc2ccc(I)c(Br)c2)c1C |
| InChI | InChI=1S/C12H12BrIN4/c1-7-11(15-2)16-6-17-12(7)18-8-3-4-10(14)9(13)5-8/h3-6H,1-2H3,(H2,15,16,17,18) |
| InChIKey | DEEFXOBBPYKLNA-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.06 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|