C14H18N2O2 — CID 114263025
(3R)-N-(1,3-dihydro-2-benzofuran-5-yl)piperidine-3-carboxamide (PubChem CID 114263025) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is (3R)-N-(1,3-dihydro-2-benzofuran-5-yl)piperidine-3-carboxamide.
| Compound Name | (3R)-N-(1,3-dihydro-2-benzofuran-5-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 114263025 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | (3R)-N-(1,3-dihydro-2-benzofuran-5-yl)piperidine-3-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)COC2)[C@@H]1CCCNC1 |
| InChI | InChI=1S/C14H18N2O2/c17-14(10-2-1-5-15-7-10)16-13-4-3-11-8-18-9-12(11)6-13/h3-4,6,10,15H,1-2,5,7-9H2,(H,16,17)/t10-/m1/s1 |
| InChIKey | PPSGDZWPLREIIY-SNVBAGLBSA-N |
| XLogP | 1.65 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |