C13H17BrN4 — CID 114263243
5-bromo-4-methyl-N-(1-methyl-3-propan-2-ylpyrazol-4-yl)pyridin-2-amine (PubChem CID 114263243) has the molecular formula C13H17BrN4 and a molecular weight of 309.21 g/mol. Its IUPAC name is 5-bromo-4-methyl-N-(1-methyl-3-propan-2-ylpyrazol-4-yl)pyridin-2-amine.
| Compound Name | 5-bromo-4-methyl-N-(1-methyl-3-propan-2-ylpyrazol-4-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 114263243 |
| Molecular Formula | C13H17BrN4 |
| Molecular Weight | 309.21 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | 5-bromo-4-methyl-N-(1-methyl-3-propan-2-ylpyrazol-4-yl)pyridin-2-amine |
| SMILES | Cc1cc(Nc2cn(C)nc2C(C)C)ncc1Br |
| InChI | InChI=1S/C13H17BrN4/c1-8(2)13-11(7-18(4)17-13)16-12-5-9(3)10(14)6-15-12/h5-8H,1-4H3,(H,15,16) |
| InChIKey | JWBGMPBFBZQTJP-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.21 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |