C11H11ClFN3O — CID 114264208
5-(2-chloro-5-fluorophenoxy)-1,3-dimethylpyrazol-4-amine (PubChem CID 114264208) has the molecular formula C11H11ClFN3O and a molecular weight of 255.68 g/mol. Its IUPAC name is 5-(2-chloro-5-fluorophenoxy)-1,3-dimethylpyrazol-4-amine.
| Compound Name | 5-(2-chloro-5-fluorophenoxy)-1,3-dimethylpyrazol-4-amine |
|---|---|
| PubChem CID | 114264208 |
| Molecular Formula | C11H11ClFN3O |
| Molecular Weight | 255.68 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | 5-(2-chloro-5-fluorophenoxy)-1,3-dimethylpyrazol-4-amine |
| SMILES | Cc1nn(C)c(Oc2cc(F)ccc2Cl)c1N |
| InChI | InChI=1S/C11H11ClFN3O/c1-6-10(14)11(16(2)15-6)17-9-5-7(13)3-4-8(9)12/h3-5H,14H2,1-2H3 |
| InChIKey | KGFJOQOYTSJPOD-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.68 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |