C16H14N2O2S — CID 11426507
Ethyl 3-(3-pyridylamino)benzothiophene-2-carboxylate (PubChem CID 11426507) has the molecular formula C16H14N2O2S and a molecular weight of 298.40 g/mol. Its IUPAC name is ethyl 3-(pyridin-3-ylamino)-1-benzothiophene-2-carboxylate.
| Compound Name | Ethyl 3-(3-pyridylamino)benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 11426507 |
| Molecular Formula | C16H14N2O2S |
| Molecular Weight | 298.40 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | ethyl 3-(pyridin-3-ylamino)-1-benzothiophene-2-carboxylate |
| SMILES | CCOC(=O)C1=C(C2=CC=CC=C2S1)NC3=CN=CC=C3 |
| InChI | InChI=1S/C16H14N2O2S/c1-2-20-16(19)15-14(18-11-6-5-9-17-10-11)12-7-3-4-8-13(12)21-15/h3-10,18H,2H2,1H3 |
| InChIKey | KVYKXZVRSXHFBC-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 79.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | 366 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.40 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |