C15H20BrNO — CID 114265418
4-[(6-bromo-2,3-dihydro-1H-inden-1-yl)amino]cyclohexan-1-ol (PubChem CID 114265418) has the molecular formula C15H20BrNO and a molecular weight of 310.23 g/mol. Its IUPAC name is 4-[(6-bromo-2,3-dihydro-1H-inden-1-yl)amino]cyclohexan-1-ol.
| Compound Name | 4-[(6-bromo-2,3-dihydro-1H-inden-1-yl)amino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 114265418 |
| Molecular Formula | C15H20BrNO |
| Molecular Weight | 310.23 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 4-[(6-bromo-2,3-dihydro-1H-inden-1-yl)amino]cyclohexan-1-ol |
| SMILES | OC1CCC(NC2CCc3ccc(Br)cc32)CC1 |
| InChI | InChI=1S/C15H20BrNO/c16-11-3-1-10-2-8-15(14(10)9-11)17-12-4-6-13(18)7-5-12/h1,3,9,12-13,15,17-18H,2,4-8H2 |
| InChIKey | WAJKVQGQTHKESC-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.23 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |