C15H13F2N — CID 114265478
6-(2,6-difluorophenyl)-2,3-dihydro-1H-inden-1-amine (PubChem CID 114265478) has the molecular formula C15H13F2N and a molecular weight of 245.27 g/mol. Its IUPAC name is 6-(2,6-difluorophenyl)-2,3-dihydro-1H-inden-1-amine.
| Compound Name | 6-(2,6-difluorophenyl)-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 114265478 |
| Molecular Formula | C15H13F2N |
| Molecular Weight | 245.27 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | 6-(2,6-difluorophenyl)-2,3-dihydro-1H-inden-1-amine |
| SMILES | NC1CCc2ccc(-c3c(F)cccc3F)cc21 |
| InChI | InChI=1S/C15H13F2N/c16-12-2-1-3-13(17)15(12)10-5-4-9-6-7-14(18)11(9)8-10/h1-5,8,14H,6-7,18H2 |
| InChIKey | XOXIHTQCQMBVQX-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.27 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |