About 6-(2,6-difluorophenyl)-2,3-dihydro-1H-inden-1-amine
6-(2,6-difluorophenyl)-2,3-dihydro-1H-inden-1-amine (PubChem CID 114265478) has the molecular formula C15H13F2N
and a molecular weight of 245.27 g/mol. Its IUPAC name is 6-(2,6-difluorophenyl)-2,3-dihydro-1H-inden-1-amine.
Molecular Properties
| Compound Name | 6-(2,6-difluorophenyl)-2,3-dihydro-1H-inden-1-amine |
| PubChem CID | 114265478 |
| Molecular Formula | C15H13F2N |
| Molecular Weight | 245.27 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | 6-(2,6-difluorophenyl)-2,3-dihydro-1H-inden-1-amine |
| SMILES | NC1CCc2ccc(-c3c(F)cccc3F)cc21 |
| InChI | InChI=1S/C15H13F2N/c16-12-2-1-3-13(17)15(12)10-5-4-9-6-7-14(18)11(9)8-10/h1-5,8,14H,6-7,18H2 |
| InChIKey | XOXIHTQCQMBVQX-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.27 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-(2,6-difluorophenyl)-2,3-dihydro-1H-inden-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2,6-difluorophenyl)-2,3-dihydro-1H-inden-1-amine?
The IUPAC name of 6-(2,6-difluorophenyl)-2,3-dihydro-1H-inden-1-amine (CID 114265478) is 6-(2,6-difluorophenyl)-2,3-dihydro-1H-inden-1-amine.
What is the SMILES notation for 6-(2,6-difluorophenyl)-2,3-dihydro-1H-inden-1-amine?
The canonical SMILES for 6-(2,6-difluorophenyl)-2,3-dihydro-1H-inden-1-amine is NC1CCc2ccc(-c3c(F)cccc3F)cc21.
What is the InChIKey of 6-(2,6-difluorophenyl)-2,3-dihydro-1H-inden-1-amine?
The InChIKey is XOXIHTQCQMBVQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13F2N/c16-12-2-1-3-13(17)15(12)10-5-4-9-6-7-14(18)11(9)8-10/h1-5,8,14H,6-7,18H2.
What are the key properties of 6-(2,6-difluorophenyl)-2,3-dihydro-1H-inden-1-amine?
6-(2,6-difluorophenyl)-2,3-dihydro-1H-inden-1-amine has a molecular weight of 245.27 g/mol, XLogP of 3.58, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,6-difluorophenyl)-2,3-dihydro-1H-inden-1-amine is sourced from PubChem (CID 114265478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).