About [4-(1,2-benzoxazol-3-yl)morpholin-3-yl]methanamine
[4-(1,2-benzoxazol-3-yl)morpholin-3-yl]methanamine (PubChem CID 114265591) has the molecular formula C12H15N3O2
and a molecular weight of 233.27 g/mol. Its IUPAC name is [4-(1,2-benzoxazol-3-yl)morpholin-3-yl]methanamine.
Molecular Properties
| Compound Name | [4-(1,2-benzoxazol-3-yl)morpholin-3-yl]methanamine |
| PubChem CID | 114265591 |
| Molecular Formula | C12H15N3O2 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | [4-(1,2-benzoxazol-3-yl)morpholin-3-yl]methanamine |
| SMILES | NCC1COCCN1c1noc2ccccc12 |
| InChI | InChI=1S/C12H15N3O2/c13-7-9-8-16-6-5-15(9)12-10-3-1-2-4-11(10)17-14-12/h1-4,9H,5-8,13H2 |
| InChIKey | KKJYHBOHBKVNSE-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [4-(1,2-benzoxazol-3-yl)morpholin-3-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(1,2-benzoxazol-3-yl)morpholin-3-yl]methanamine?
The IUPAC name of [4-(1,2-benzoxazol-3-yl)morpholin-3-yl]methanamine (CID 114265591) is [4-(1,2-benzoxazol-3-yl)morpholin-3-yl]methanamine.
What is the SMILES notation for [4-(1,2-benzoxazol-3-yl)morpholin-3-yl]methanamine?
The canonical SMILES for [4-(1,2-benzoxazol-3-yl)morpholin-3-yl]methanamine is NCC1COCCN1c1noc2ccccc12.
What is the InChIKey of [4-(1,2-benzoxazol-3-yl)morpholin-3-yl]methanamine?
The InChIKey is KKJYHBOHBKVNSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3O2/c13-7-9-8-16-6-5-15(9)12-10-3-1-2-4-11(10)17-14-12/h1-4,9H,5-8,13H2.
What are the key properties of [4-(1,2-benzoxazol-3-yl)morpholin-3-yl]methanamine?
[4-(1,2-benzoxazol-3-yl)morpholin-3-yl]methanamine has a molecular weight of 233.27 g/mol, XLogP of 0.99, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(1,2-benzoxazol-3-yl)morpholin-3-yl]methanamine is sourced from PubChem (CID 114265591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).