C12H15N3O2 — CID 114265591
[4-(1,2-benzoxazol-3-yl)morpholin-3-yl]methanamine (PubChem CID 114265591) has the molecular formula C12H15N3O2 and a molecular weight of 233.27 g/mol. Its IUPAC name is [4-(1,2-benzoxazol-3-yl)morpholin-3-yl]methanamine.
| Compound Name | [4-(1,2-benzoxazol-3-yl)morpholin-3-yl]methanamine |
|---|---|
| PubChem CID | 114265591 |
| Molecular Formula | C12H15N3O2 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | [4-(1,2-benzoxazol-3-yl)morpholin-3-yl]methanamine |
| SMILES | NCC1COCCN1c1noc2ccccc12 |
| InChI | InChI=1S/C12H15N3O2/c13-7-9-8-16-6-5-15(9)12-10-3-1-2-4-11(10)17-14-12/h1-4,9H,5-8,13H2 |
| InChIKey | KKJYHBOHBKVNSE-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |