C14H26N2O2 — CID 114266152
2-[2-[(1-hydroxy-4,4-dimethylcyclohexyl)methylamino]ethoxy]propanenitrile (PubChem CID 114266152) has the molecular formula C14H26N2O2 and a molecular weight of 254.37 g/mol. Its IUPAC name is 2-[2-[(1-hydroxy-4,4-dimethylcyclohexyl)methylamino]ethoxy]propanenitrile.
| Compound Name | 2-[2-[(1-hydroxy-4,4-dimethylcyclohexyl)methylamino]ethoxy]propanenitrile |
|---|---|
| PubChem CID | 114266152 |
| Molecular Formula | C14H26N2O2 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.20 |
| IUPAC Name | 2-[2-[(1-hydroxy-4,4-dimethylcyclohexyl)methylamino]ethoxy]propanenitrile |
| SMILES | CC(C#N)OCCNCC1(O)CCC(C)(C)CC1 |
| InChI | InChI=1S/C14H26N2O2/c1-12(10-15)18-9-8-16-11-14(17)6-4-13(2,3)5-7-14/h12,16-17H,4-9,11H2,1-3H3 |
| InChIKey | SKNOYEHOLBRSHX-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 65.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|