C13H19FN2OS — CID 114266238
2-[2-(N-ethyl-2-fluoroanilino)ethoxy]propanethioamide (PubChem CID 114266238) has the molecular formula C13H19FN2OS and a molecular weight of 270.37 g/mol. Its IUPAC name is 2-[2-(N-ethyl-2-fluoroanilino)ethoxy]propanethioamide.
| Compound Name | 2-[2-(N-ethyl-2-fluoroanilino)ethoxy]propanethioamide |
|---|---|
| PubChem CID | 114266238 |
| Molecular Formula | C13H19FN2OS |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 2-[2-(N-ethyl-2-fluoroanilino)ethoxy]propanethioamide |
| SMILES | CCN(CCOC(C)C(N)=S)c1ccccc1F |
| InChI | InChI=1S/C13H19FN2OS/c1-3-16(8-9-17-10(2)13(15)18)12-7-5-4-6-11(12)14/h4-7,10H,3,8-9H2,1-2H3,(H2,15,18) |
| InChIKey | UCWBMECXXXNDCB-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|